cas: 955-10-2 — see every product listed under this CAS number, including other names
3-Phenyl-2H-chromen-2-one 95% (CAS 955-10-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A481866-100mg |
| cas | 955-10-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 481.62 Pln | |
| Ambeed | 5g | 1733.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A481866 |
3-phenylchromen-2-one (CAS 955-10-2) is a chemical compound with the molecular formula C15H10O2 and a molecular weight of 222.24 g/mol. IUPAC name: 3-phenylchromen-2-one. InChIKey: HWDSXZLYIKESML-UHFFFAOYSA-N.
| Molecular formula | C15H10O2 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 3-phenylchromen-2-one |
| InChIKey | HWDSXZLYIKESML-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=CC=CC=C3OC2=O |
Computed by PubChem (NCBI)