3-Phenoxypiperidine hydrochloride, 97%
cas: 1171992-10-1 — see every product listed under this CAS number, including other names
3-Phenoxypiperidine hydrochloride, 97% (CAS 1171992-10-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A147520-250mg |
| cas | 1171992-10-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 898.81 Pln | |
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 1082.00 Pln | |
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 430.07 Pln | |
| Fluorochem | 1g | 919.49 Pln | |
| BLDpharm | 100mg | 386.56 Pln | |
| BLDpharm | 250mg | 464.31 Pln | |
| BLDpharm | 1g | 964.13 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-phenoxypiperidine;hydrochloride (CAS 1171992-10-1) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 3-phenoxypiperidine;hydrochloride. InChIKey: NOIVAVLUDPXIBM-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 3-phenoxypiperidine;hydrochloride |
| InChIKey | NOIVAVLUDPXIBM-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)OC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)