cas: 1225954-02-8 — see every product listed under this CAS number, including other names
3-Phenyl-2-(pyridin-2-yl)propan-1-amine, 97% (CAS 1225954-02-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A629836-1g |
| cas | 1225954-02-8 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 4900.42 Pln | |
| Fluorochem | 100mg | 862.21 Pln | |
| Fluorochem | 250mg | 1320.39 Pln | |
| Fluorochem | 500mg | 2392.93 Pln | |
| Fluorochem | 1g | 3064.56 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-phenyl-2-pyridin-2-ylpropan-1-amine (CAS 1225954-02-8) is a chemical compound with the molecular formula C14H16N2 and a molecular weight of 212.29 g/mol. IUPAC name: 3-phenyl-2-pyridin-2-ylpropan-1-amine. InChIKey: JLFXXFICMQGLRU-UHFFFAOYSA-N.
| Molecular formula | C14H16N2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | 3-phenyl-2-pyridin-2-ylpropan-1-amine |
| InChIKey | JLFXXFICMQGLRU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(CN)C2=CC=CC=N2 |
Computed by PubChem (NCBI)