cas: 18741-24-7 — see every product listed under this CAS number, including other names
3-Phenyl-2-thioxo-2,3-dihydroquinazolin-4(1H)-one, 95%+, 95%+ (CAS 18741-24-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1185U5-100mg |
| cas | 18741-24-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 386.00 Pln | |
| Chemat | 500mg | 774.80 Pln | |
| Chemat | 1g | 1230.80 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
3-phenyl-2-sulfanylidene-1H-quinazolin-4-one (CAS 18741-24-7) is a chemical compound with the molecular formula C14H10N2OS and a molecular weight of 254.31 g/mol. IUPAC name: 3-phenyl-2-sulfanylidene-1H-quinazolin-4-one. InChIKey: CRGOYNYLYMPGKH-UHFFFAOYSA-N.
| Molecular formula | C14H10N2OS |
|---|---|
| Molecular weight | 254.31 g/mol |
| IUPAC name | 3-phenyl-2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | CRGOYNYLYMPGKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=CC=CC=C3NC2=S |
Computed by PubChem (NCBI)