cas: 116511-28-5 — see every product listed under this CAS number, including other names
3-Pyridinecarboxylicacid, 1,2,5,6-tetrahydro-1-methyl-, 2-propyn-1-yl ester, hydrobromide (1:1), 95%, 95% (CAS 116511-28-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111CO4-100mg |
| cas | 116511-28-5 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 818.00 Pln | |
| Chemat | 250mg | 1576.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Prop-2-ynyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate;hydrobromide (CAS 116511-28-5) is a chemical compound with the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. IUPAC name: prop-2-ynyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate;hydrobromide. InChIKey: LRPUAFALRBYLTA-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO2 |
|---|---|
| Molecular weight | 260.13 g/mol |
| IUPAC name | prop-2-ynyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate;hydrobromide |
| InChIKey | LRPUAFALRBYLTA-UHFFFAOYSA-N |
| SMILES | CN1CCC=C(C1)C(=O)OCC#C.Br |
Computed by PubChem (NCBI)