cas: 116511-28-5 — see every product listed under this CAS number, including other names
Arecaidine propargyl ester (hydrobromide) (CAS 116511-28-5) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg. Offered by: GLPBio, TargetMol.
| brand | GLPBio |
|---|---|
| catalog number | GC49314-5 |
| cas | 116511-28-5 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 5mg | 802.98 Pln | |
| TargetMol | 5mg | 1176.01 Pln | |
| TargetMol | 10mg | 2046.38 Pln | |
| TargetMol | 25mg | 3593.69 Pln | |
| GLPBio | 10mg | 1116.58 Pln | |
| GLPBio | 25mg | 2085.44 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Prop-2-ynyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate;hydrobromide (CAS 116511-28-5) is a chemical compound with the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. IUPAC name: prop-2-ynyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate;hydrobromide. InChIKey: LRPUAFALRBYLTA-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO2 |
|---|---|
| Molecular weight | 260.13 g/mol |
| IUPAC name | prop-2-ynyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate;hydrobromide |
| InChIKey | LRPUAFALRBYLTA-UHFFFAOYSA-N |
| SMILES | CN1CCC=C(C1)C(=O)OCC#C.Br |
Computed by PubChem (NCBI)