CAS 263349-22-0 is the registry number for 3-Pyrimidin-2-ylbenzaldehyde, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g, 10g.
3-pyrimidin-2-ylbenzaldehyde (CAS 263349-22-0) is a chemical compound with the molecular formula C11H8N2O and a molecular weight of 184.19 g/mol. IUPAC name: 3-pyrimidin-2-ylbenzaldehyde. InChIKey: ZBAZYPXXIVHUFO-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 3-pyrimidin-2-ylbenzaldehyde |
| InChIKey | ZBAZYPXXIVHUFO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=NC=CC=N2)C=O |
Computed by PubChem (NCBI)