CAS 24223-07-2 appears in our catalog under these names: 9H–Pyrido(3,4–b)indole, 2–oxide, 9H-Pyrido[3,4-b]indole, 2-oxide, 95%, 9H-pyrido(3,4-b)indole 2-oxide, 98%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 25mg, 5mg, 1g, 250mg, 100mg.
2-hydroxypyrido[3,4-b]indole (CAS 24223-07-2) is a chemical compound with the molecular formula C11H8N2O and a molecular weight of 184.19 g/mol. IUPAC name: 2-hydroxypyrido[3,4-b]indole. InChIKey: IRDLFNVGQPUJLH-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2-hydroxypyrido[3,4-b]indole |
| InChIKey | IRDLFNVGQPUJLH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C=CN(C=C3N=C2C=C1)O |
Computed by PubChem (NCBI)