cas: 1048389-82-7 — see every product listed under this CAS number, including other names
3-TERT-BUTYL-1-(2,2,2-TRIFLUOROETHYL)-1H-PYRAZOL-5-AMINE, 95%, 95% (CAS 1048389-82-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HAF9-100mg |
| cas | 1048389-82-7 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 678.80 Pln | |
| Chemat | 1g | 1605.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-tert-butyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine (CAS 1048389-82-7) is a chemical compound with the molecular formula C9H14F3N3 and a molecular weight of 221.22 g/mol. IUPAC name: 3-tert-butyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine. InChIKey: ULDPQKCPIAKINS-UHFFFAOYSA-N.
| Molecular formula | C9H14F3N3 |
|---|---|
| Molecular weight | 221.22 g/mol |
| IUPAC name | 3-tert-butyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine |
| InChIKey | ULDPQKCPIAKINS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=C1)N)CC(F)(F)F |
Computed by PubChem (NCBI)