CAS 1006348-75-9 appears in our catalog under these names: 2-Methyl-3-[3-methyl-5-(trifluoromethyl)-1h-pyrazol-1-yl]-1-propanamine, 95%, 2-Methyl-3-(3-methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl)propan-1-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10g.
2-methyl-3-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]propan-1-amine (CAS 1006348-75-9) is a chemical compound with the molecular formula C9H14F3N3 and a molecular weight of 221.22 g/mol. IUPAC name: 2-methyl-3-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]propan-1-amine. InChIKey: KXBCPRSVJPVCNI-UHFFFAOYSA-N.
| Molecular formula | C9H14F3N3 |
|---|---|
| Molecular weight | 221.22 g/mol |
| IUPAC name | 2-methyl-3-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]propan-1-amine |
| InChIKey | KXBCPRSVJPVCNI-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C(F)(F)F)CC(C)CN |
Computed by PubChem (NCBI)