cas: 27328-86-5 — see every product listed under this CAS number, including other names
3-Trifluoromethylbenzoylacetonitrile, 97% (CAS 27328-86-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F206982-1G |
| cas | 27328-86-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 10g | 419.66 Pln | |
| Fluorochem | 25g | 955.93 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-oxo-3-[3-(trifluoromethyl)phenyl]propanenitrile (CAS 27328-86-5) is a chemical compound with the molecular formula C10H6F3NO and a molecular weight of 213.16 g/mol. IUPAC name: 3-oxo-3-[3-(trifluoromethyl)phenyl]propanenitrile. InChIKey: GEPORLBYZLQDOB-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | 3-oxo-3-[3-(trifluoromethyl)phenyl]propanenitrile |
| InChIKey | GEPORLBYZLQDOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(=O)CC#N |
Computed by PubChem (NCBI)