CAS 492-16-0 is the registry number for 2-Phenyl-2-(trifluoroacetyl)acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
4,4,4-trifluoro-3-oxo-2-phenylbutanenitrile (CAS 492-16-0) is a chemical compound with the molecular formula C10H6F3NO and a molecular weight of 213.16 g/mol. IUPAC name: 4,4,4-trifluoro-3-oxo-2-phenylbutanenitrile. InChIKey: BLFCSOQPFPFQHF-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | 4,4,4-trifluoro-3-oxo-2-phenylbutanenitrile |
| InChIKey | BLFCSOQPFPFQHF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C#N)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)