cas: 85092-82-6 — see every product listed under this CAS number, including other names
3-bromo-5-chloro-1H-indole, 96%, 96% (CAS 85092-82-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115XNH-100mg |
| cas | 85092-82-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 500mg | 654.80 Pln | |
| Chemat | 1g | 957.20 Pln | |
| Chemat | 5g | 2757.20 Pln | |
| Chemat | 10g | 4557.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3-bromo-5-chloro-1H-indole (CAS 85092-82-6) is a chemical compound with the molecular formula C8H5BrClN and a molecular weight of 230.49 g/mol. IUPAC name: 3-bromo-5-chloro-1H-indole. InChIKey: DYTMTLPTFUWUSO-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClN |
|---|---|
| Molecular weight | 230.49 g/mol |
| IUPAC name | 3-bromo-5-chloro-1H-indole |
| InChIKey | DYTMTLPTFUWUSO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CN2)Br |
Computed by PubChem (NCBI)