CAS 1261815-64-8 is the registry number for 2-Bromo-3-chlorophenylacetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2-bromo-3-chlorophenyl)acetonitrile (CAS 1261815-64-8) is a chemical compound with the molecular formula C8H5BrClN and a molecular weight of 230.49 g/mol. IUPAC name: 2-(2-bromo-3-chlorophenyl)acetonitrile. InChIKey: HPUGXAIJAQEURT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClN |
|---|---|
| Molecular weight | 230.49 g/mol |
| IUPAC name | 2-(2-bromo-3-chlorophenyl)acetonitrile |
| InChIKey | HPUGXAIJAQEURT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Br)CC#N |
Computed by PubChem (NCBI)