cas: 306-20-7 — see every product listed under this CAS number, including other names
3-chloro-N-(2-phenylethyl)propanamide (CAS 306-20-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BF6Z-1mg |
| cas | 306-20-7 |
| size | 1mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 146.00 Pln | |
| Chemat | 5mg | 256.40 Pln | |
| Chemat | 10mg | 338.00 Pln | |
| Chemat | 25mg | 563.60 Pln | |
| Chemat | 50mg | 822.80 Pln | |
| Chemat | 100mg | 1202.00 Pln | |
| Chemat | 200mg | 1701.20 Pln |
| delivery time | 3 weeks |
|---|
3-chloro-N-(2-phenylethyl)propanamide (CAS 306-20-7) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: 3-chloro-N-(2-phenylethyl)propanamide. InChIKey: BITWVVLBVUMFHU-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | 3-chloro-N-(2-phenylethyl)propanamide |
| InChIKey | BITWVVLBVUMFHU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCNC(=O)CCCl |
Computed by PubChem (NCBI)