CAS 82820-74-4 appears in our catalog under these names: 3-Chloro-2,2-dimethyl-n-phenylpropanamide, 95%, 3-Chloro-2,2-dimethyl-N-phenylpropanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g.
3-chloro-2,2-dimethyl-N-phenylpropanamide (CAS 82820-74-4) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: 3-chloro-2,2-dimethyl-N-phenylpropanamide. InChIKey: GRKXHRAZNFTCCO-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | 3-chloro-2,2-dimethyl-N-phenylpropanamide |
| InChIKey | GRKXHRAZNFTCCO-UHFFFAOYSA-N |
| SMILES | CC(C)(CCl)C(=O)NC1=CC=CC=C1 |
Computed by PubChem (NCBI)