cas: 1619991-78-4 — see every product listed under this CAS number, including other names
3-ethyl-1-methyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 98% (CAS 1619991-78-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F519378-5G |
| cas | 1619991-78-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 9603.93 Pln | |
| Fluorochem | 100mg | 659.16 Pln | |
| Fluorochem | 250mg | 966.34 Pln | |
| Fluorochem | 500mg | 1721.29 Pln | |
| Fluorochem | 1g | 2387.72 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-ethyl-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1619991-78-4) is a chemical compound with the molecular formula C12H21BN2O2 and a molecular weight of 236.12 g/mol. IUPAC name: 3-ethyl-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: YLKPOHNZXRNSDB-UHFFFAOYSA-N.
| Molecular formula | C12H21BN2O2 |
|---|---|
| Molecular weight | 236.12 g/mol |
| IUPAC name | 3-ethyl-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | YLKPOHNZXRNSDB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2CC)C |
Computed by PubChem (NCBI)