cas: 1171892-42-4 — see every product listed under this CAS number, including other names
3-isopropoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95%, 95% (CAS 1171892-42-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111DV3-100mg |
| cas | 1171892-42-4 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 554.00 Pln | |
| Chemat | 5g | 2517.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-propan-2-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1171892-42-4) is a chemical compound with the molecular formula C14H22BNO3 and a molecular weight of 263.14 g/mol. IUPAC name: 3-propan-2-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: DPMKLRJKZXEWSN-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO3 |
|---|---|
| Molecular weight | 263.14 g/mol |
| IUPAC name | 3-propan-2-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | DPMKLRJKZXEWSN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)OC(C)C |
Computed by PubChem (NCBI)