cas: 4185-00-6 — see every product listed under this CAS number, including other names
3-oxo chenodeoxycholic acid 98% (CAS 4185-00-6) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1666018-5mg |
| cas | 4185-00-6 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 459.38 Pln | |
| Ambeed | 10mg | 681.88 Pln | |
| Ambeed | 25mg | 1238.12 Pln | |
| Ambeed | 50mg | 2061.38 Pln | |
| Ambeed | 100mg | 3452.00 Pln | |
| Ambeed | 250mg | 6160.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1666018 |
7alpha-hydroxy-3-oxo-5beta-cholan-24-oic acid is a 3-oxo steroid that is chenodeoxycholic acid in which the hydroxy group at position 3 has undergone formal oxidation to the corresponding ketone. It has a role as a human metabolite. It is a 3-oxo-5beta-steroid, a bile acid, a monohydroxy-5beta-cholanic acid and a 7alpha-hydroxy steroid. It is a conjugate acid of a 7alpha-hydroxy-3-oxo-5beta-cholan-24-oate.
Source: ChEBI
| Molecular formula | C24H38O4 |
|---|---|
| Molecular weight | 390.6 g/mol |
| IUPAC name | (4R)-4-[(5R,7R,8R,9S,10S,13R,14S,17R)-7-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| InChIKey | KNVADAPHVNKTEP-CIGXQKLNSA-N |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CCC(=O)C4)C)O)C |
Computed by PubChem (NCBI)