Products 4654-26-6

CAS 4654-26-6 is the registry number for Dioctyl terephthalate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 500g, 100g, 1kg, 5g.

Structural formula: {0} (CAS {1})

Dioctyl benzene-1,4-dicarboxylate (CAS 4654-26-6) is a chemical compound with the molecular formula C24H38O4 and a molecular weight of 390.6 g/mol. IUPAC name: dioctyl benzene-1,4-dicarboxylate. InChIKey: OEIWPNWSDYFMIL-UHFFFAOYSA-N.

Identity
Molecular formulaC24H38O4
Molecular weight390.6 g/mol
IUPAC namedioctyl benzene-1,4-dicarboxylate
InChIKeyOEIWPNWSDYFMIL-UHFFFAOYSA-N
SMILESCCCCCCCCOC(=O)C1=CC=C(C=C1)C(=O)OCCCCCCCC

Computed by PubChem (NCBI)