3H-2,1-Benzoxathiol-3-one, 1,1-dioxide, 98%, 98%
cas: 81-08-3 — see every product listed under this CAS number, including other names
3H-2,1-Benzoxathiol-3-one, 1,1-dioxide, 98%, 98% (CAS 81-08-3) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1kg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114B0Q-500g |
| cas | 81-08-3 |
| size | 500g |
| availability | 2000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 500g | 1027.20 Pln | |
| Chemat | 1kg | 1768.40 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 50g | 194.00 Pln | |
| Chemat | 100g | 304.40 Pln | |
| Chemat | 250g | 611.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,1-dioxo-2,1lambda6-benzoxathiol-3-one (CAS 81-08-3) is a chemical compound with the molecular formula C7H4O4S and a molecular weight of 184.17 g/mol. IUPAC name: 1,1-dioxo-2,1lambda6-benzoxathiol-3-one. InChIKey: NCYNKWQXFADUOZ-UHFFFAOYSA-N.
| Molecular formula | C7H4O4S |
|---|---|
| Molecular weight | 184.17 g/mol |
| IUPAC name | 1,1-dioxo-2,1lambda6-benzoxathiol-3-one |
| InChIKey | NCYNKWQXFADUOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OS2(=O)=O |
Computed by PubChem (NCBI)
Synonyms:
2-Sulfobenzoic acid cyclic anhydride, o-Sulfobenzoic acid anhydride, o-Sulfobenzoic anhydride, o-Sulfobenzoic acid, cyclic anhydride, Benzoic acid, 2-sulfo-, cyclic anhydride, Benzoic acid, o-sulfo-, cyclic anhydride, 2-sulfobenzoic cyclic anhydride, 2-Sulfobenzoic anhydride, Sulfobenzoic anhydride, 3H-2,1-Benzoxathiol-3-one, 1,1-dioxide