CAS 81-08-3 appears in our catalog under these names: 2-Sulfobenzoic anhydride, 95%, 2-Sulfobenzoic Anhydride, 2-Sulfobenzoic anhydride, 94% , 2-Sulfobenzoic Anhydride, >97.0%(T), 2-Sulfobenzoic acid cyclic anhydride, 95%. Offered by: Combi-blocks, AmBeed, TRC, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 25g, 5g, 100g, 1g, 10g, 50g, 500g, 1000g.
1,1-dioxo-2,1lambda6-benzoxathiol-3-one (CAS 81-08-3) is a chemical compound with the molecular formula C7H4O4S and a molecular weight of 184.17 g/mol. IUPAC name: 1,1-dioxo-2,1lambda6-benzoxathiol-3-one. InChIKey: NCYNKWQXFADUOZ-UHFFFAOYSA-N.
| Molecular formula | C7H4O4S |
|---|---|
| Molecular weight | 184.17 g/mol |
| IUPAC name | 1,1-dioxo-2,1lambda6-benzoxathiol-3-one |
| InChIKey | NCYNKWQXFADUOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OS2(=O)=O |
Computed by PubChem (NCBI)