cas: 172733-79-8 — see every product listed under this CAS number, including other names
3H-Spiro(isobenzofuran-1,4'-piperidin)-3-one hydrochloride, 98% (CAS 172733-79-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A935275-100mg |
| cas | 172733-79-8 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 1625.89 Pln | |
| AmBeed | 250mg | 2667.49 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Spiro[2-benzofuran-3,4'-piperidine]-1-one;hydrochloride (CAS 172733-79-8) is a chemical compound with the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. IUPAC name: spiro[2-benzofuran-3,4'-piperidine]-1-one;hydrochloride. InChIKey: JDUFOCPANLQXPS-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO2 |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | spiro[2-benzofuran-3,4'-piperidine]-1-one;hydrochloride |
| InChIKey | JDUFOCPANLQXPS-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=CC=CC=C3C(=O)O2.Cl |
Computed by PubChem (NCBI)