Products 813425-70-6

CAS 813425-70-6 is the registry number for Trans (+/-) 4-(4-chlorophenyl)pyrrolidine-3-methylcarboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl (3R,4S)-4-(4-chlorophenyl)pyrrolidine-3-carboxylate (CAS 813425-70-6) is a chemical compound with the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. IUPAC name: methyl (3R,4S)-4-(4-chlorophenyl)pyrrolidine-3-carboxylate. InChIKey: SFAIJGZFZQBGLO-MNOVXSKESA-N.

Identity
Molecular formulaC12H14ClNO2
Molecular weight239.70 g/mol
IUPAC namemethyl (3R,4S)-4-(4-chlorophenyl)pyrrolidine-3-carboxylate
InChIKeySFAIJGZFZQBGLO-MNOVXSKESA-N
SMILESCOC(=O)[C@H]1CNC[C@@H]1C2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)