cas: 1219741-54-4 — see every product listed under this CAS number, including other names
4'-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-(1,1'-biphenyl)-2-ol, 95-<97% (CAS 1219741-54-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC178-95-97-10g |
| cas | 1219741-54-4 |
| size | 10g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 10g | 3912.70 Pln | |
| Hoffman Fine Chemicals | 25g | 7523.78 Pln | |
| Hoffman Fine Chemicals | 50g | 11849.42 Pln | |
| Hoffman Fine Chemicals | 100g | 18778.10 Pln | |
| Hoffman Fine Chemicals | 200g | 31710.36 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenol (CAS 1219741-54-4) is a chemical compound with the molecular formula C18H21BO3 and a molecular weight of 296.2 g/mol. IUPAC name: 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenol. InChIKey: KHMILAPQGZSSST-UHFFFAOYSA-N.
| Molecular formula | C18H21BO3 |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenol |
| InChIKey | KHMILAPQGZSSST-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CC=CC=C3O |
Computed by PubChem (NCBI)