cas: 1219741-54-4 — see every product listed under this CAS number, including other names
4'-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,1'-biphenyl]-2-ol, 96% (CAS 1219741-54-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F450151-100MG |
| cas | 1219741-54-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 232.23 Pln | |
| Fluorochem | 250mg | 247.85 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenol (CAS 1219741-54-4) is a chemical compound with the molecular formula C18H21BO3 and a molecular weight of 296.2 g/mol. IUPAC name: 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenol. InChIKey: KHMILAPQGZSSST-UHFFFAOYSA-N.
| Molecular formula | C18H21BO3 |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenol |
| InChIKey | KHMILAPQGZSSST-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CC=CC=C3O |
Computed by PubChem (NCBI)