4'-(4-Nitrophenyl)-2,2':6',2''-terpyridine, 98%
cas: 129077-51-6 — see every product listed under this CAS number, including other names
4'-(4-Nitrophenyl)-2,2':6',2''-terpyridine, 98% (CAS 129077-51-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A144315-100mg |
| cas | 129077-51-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1499.56 Pln | |
| Chemat | 100mg | 438.80 Pln | |
| Chemat | 250mg | 626.00 Pln | |
| Chemat | 1g | 1614.80 Pln | |
| BLDpharm | 100mg | 403.22 Pln | |
| BLDpharm | 250mg | 636.47 Pln | |
| BLDpharm | 1g | 1608.35 Pln | |
| Fluorochem | 100mg | 794.53 Pln | |
| Fluorochem | 250mg | 1148.57 Pln | |
| Fluorochem | 1g | 3007.29 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-(4-nitrophenyl)-2,6-dipyridin-2-ylpyridine (CAS 129077-51-6) is a chemical compound with the molecular formula C21H14N4O2 and a molecular weight of 354.4 g/mol. IUPAC name: 4-(4-nitrophenyl)-2,6-dipyridin-2-ylpyridine. InChIKey: SLAKPUZCHMXDSL-UHFFFAOYSA-N.
| Molecular formula | C21H14N4O2 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 4-(4-nitrophenyl)-2,6-dipyridin-2-ylpyridine |
| InChIKey | SLAKPUZCHMXDSL-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)C4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)