CAS 13960-33-3 is the registry number for 2-(4-Nitrophenyl)-4,6-diphenyl-1,3,5-triazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-nitrophenyl)-4,6-diphenyl-1,3,5-triazine (CAS 13960-33-3) is a chemical compound with the molecular formula C21H14N4O2 and a molecular weight of 354.4 g/mol. IUPAC name: 2-(4-nitrophenyl)-4,6-diphenyl-1,3,5-triazine. InChIKey: YAUTZNGTYHUKQR-UHFFFAOYSA-N.
| Molecular formula | C21H14N4O2 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-4,6-diphenyl-1,3,5-triazine |
| InChIKey | YAUTZNGTYHUKQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=C(C=C3)[N+](=O)[O-])C4=CC=CC=C4 |
Computed by PubChem (NCBI)