Products 34956-31-5
CAS 34956-31-5 appears in our catalog under these names: 4'–Acetamido–2'–methylacetophenone, 4'-Acetamido-2'-methylacetophenone, 97% , 4'-Acetamido-2'-methylacetophenone, 4'-Acetamido-2'-methylacetophenone, >98.0%(GC), N-(4-Acetyl-3-methylphenyl)acetamide 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 1g, 25g, 5g, 10g, 250mg.
N-(4-acetyl-3-methylphenyl)acetamide (CAS 34956-31-5) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: N-(4-acetyl-3-methylphenyl)acetamide. InChIKey: PTARWPNYVATTDE-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | N-(4-acetyl-3-methylphenyl)acetamide |
| InChIKey | PTARWPNYVATTDE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)C)C(=O)C |
Computed by PubChem (NCBI)