cas: 470461-09-7 — see every product listed under this CAS number, including other names
4'-BROMO-4-ETHOXY-2,3-DIFLUORO-1,1'-BIPHENYL, 98% (CAS 470461-09-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467264-100MG |
| cas | 470461-09-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 945.52 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-bromophenyl)-4-ethoxy-2,3-difluorobenzene (CAS 470461-09-7) is a chemical compound with the molecular formula C14H11BrF2O and a molecular weight of 313.14 g/mol. IUPAC name: 1-(4-bromophenyl)-4-ethoxy-2,3-difluorobenzene. InChIKey: VFNYZNWPLITFPE-UHFFFAOYSA-N.
| Molecular formula | C14H11BrF2O |
|---|---|
| Molecular weight | 313.14 g/mol |
| IUPAC name | 1-(4-bromophenyl)-4-ethoxy-2,3-difluorobenzene |
| InChIKey | VFNYZNWPLITFPE-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)C2=CC=C(C=C2)Br)F)F |
Computed by PubChem (NCBI)