Products 1296274-23-1
CAS 1296274-23-1 appears in our catalog under these names: 2–(4'–bromo–(1，1'–biphenyl)–4–yl)–2，2–difluoroethan–1–ol, 2-(4'-bromo-[1,1'-biphenyl]-4-yl)-2,2-difluoroethan-1-ol. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g.
2-[4-(4-bromophenyl)phenyl]-2,2-difluoroethanol (CAS 1296274-23-1) is a chemical compound with the molecular formula C14H11BrF2O and a molecular weight of 313.14 g/mol. IUPAC name: 2-[4-(4-bromophenyl)phenyl]-2,2-difluoroethanol. InChIKey: BAISYJHVGJZNAR-UHFFFAOYSA-N.
| Molecular formula | C14H11BrF2O |
|---|---|
| Molecular weight | 313.14 g/mol |
| IUPAC name | 2-[4-(4-bromophenyl)phenyl]-2,2-difluoroethanol |
| InChIKey | BAISYJHVGJZNAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Br)C(CO)(F)F |
Computed by PubChem (NCBI)