cas: 57774-35-3 — see every product listed under this CAS number, including other names
4'-Bromo-[1,1'-biphenyl]-4-carbonitrile 95% (CAS 57774-35-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A270749-1g |
| cas | 57774-35-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 270.25 Pln | |
| Ambeed | 25g | 592.88 Pln | |
| Ambeed | 100g | 2161.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A270749 |
4-(4-bromophenyl)benzonitrile (CAS 57774-35-3) is a chemical compound with the molecular formula C13H8BrN and a molecular weight of 258.11 g/mol. IUPAC name: 4-(4-bromophenyl)benzonitrile. InChIKey: BHVHKOVPWZKVCC-UHFFFAOYSA-N.
| Molecular formula | C13H8BrN |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 4-(4-bromophenyl)benzonitrile |
| InChIKey | BHVHKOVPWZKVCC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)