cas: 35450-34-1 — see every product listed under this CAS number, including other names
4'-Bromo-2-Nitro-1,1'-biphenyl 95+% (CAS 35450-34-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A658917-250mg |
| cas | 35450-34-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A658917 |
1-(4-bromophenyl)-2-nitrobenzene (CAS 35450-34-1) is a chemical compound with the molecular formula C12H8BrNO2 and a molecular weight of 278.10 g/mol. IUPAC name: 1-(4-bromophenyl)-2-nitrobenzene. InChIKey: SVAHHCNTAZYUAT-UHFFFAOYSA-N.
| Molecular formula | C12H8BrNO2 |
|---|---|
| Molecular weight | 278.10 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2-nitrobenzene |
| InChIKey | SVAHHCNTAZYUAT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)