CAS 35450-34-1 appears in our catalog under these names: 4'-Bromo-2-nitrobiphenyl, 98%, 4'-Bromo-2-Nitro-1,1'-biphenyl 95+%, 4'-Bromo-2-nitrobiphenyl, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 250mg, 10g, 25g, 1g, 5g.
1-(4-bromophenyl)-2-nitrobenzene (CAS 35450-34-1) is a chemical compound with the molecular formula C12H8BrNO2 and a molecular weight of 278.10 g/mol. IUPAC name: 1-(4-bromophenyl)-2-nitrobenzene. InChIKey: SVAHHCNTAZYUAT-UHFFFAOYSA-N.
| Molecular formula | C12H8BrNO2 |
|---|---|
| Molecular weight | 278.10 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2-nitrobenzene |
| InChIKey | SVAHHCNTAZYUAT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)