cas: 470461-09-7 — see every product listed under this CAS number, including other names
4'-Bromo-4-ethoxy-2,3-difluoro-1,1'-biphenyl 98% (CAS 470461-09-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A286721-5g |
| cas | 470461-09-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 2055.81 Pln | |
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 470.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A286721 |
1-(4-bromophenyl)-4-ethoxy-2,3-difluorobenzene (CAS 470461-09-7) is a chemical compound with the molecular formula C14H11BrF2O and a molecular weight of 313.14 g/mol. IUPAC name: 1-(4-bromophenyl)-4-ethoxy-2,3-difluorobenzene. InChIKey: VFNYZNWPLITFPE-UHFFFAOYSA-N.
| Molecular formula | C14H11BrF2O |
|---|---|
| Molecular weight | 313.14 g/mol |
| IUPAC name | 1-(4-bromophenyl)-4-ethoxy-2,3-difluorobenzene |
| InChIKey | VFNYZNWPLITFPE-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)C2=CC=C(C=C2)Br)F)F |
Computed by PubChem (NCBI)