cas: 36871-55-3 — see every product listed under this CAS number, including other names
4'-CHLORO-2'-METHOXYPROPIOPHENONE, 97% (CAS 36871-55-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F533016-1G |
| cas | 36871-55-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 450.90 Pln | |
| Fluorochem | 5g | 1237.08 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-chloro-2-methoxyphenyl)propan-1-one (CAS 36871-55-3) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 1-(4-chloro-2-methoxyphenyl)propan-1-one. InChIKey: PELVKTMDDXVZAT-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 1-(4-chloro-2-methoxyphenyl)propan-1-one |
| InChIKey | PELVKTMDDXVZAT-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=C(C=C1)Cl)OC |
Computed by PubChem (NCBI)