CAS 128143-89-5 appears in our catalog under these names: 4'–Chloro–2,2':6',2''–terpyridine, 4'-Chloro-2,2':6',2''-terpyridine, 98% , 4'-Chloro-2,2':6',2''-terpyridine, >98.0%(GC)(T), 4'-Chloro-2,2':6',2''-terpyridine, 99%, 4'-Chloro-2,2':6',2''-terpyridine, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 10g, 1g, 25g, 5g, 250mg, 200mg, 100mg.
4-chloro-2,6-dipyridin-2-ylpyridine (CAS 128143-89-5) is a chemical compound with the molecular formula C15H10ClN3 and a molecular weight of 267.71 g/mol. IUPAC name: 4-chloro-2,6-dipyridin-2-ylpyridine. InChIKey: AHEMFMCEBIJRMU-UHFFFAOYSA-N.
| Molecular formula | C15H10ClN3 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | 4-chloro-2,6-dipyridin-2-ylpyridine |
| InChIKey | AHEMFMCEBIJRMU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)Cl |
Computed by PubChem (NCBI)