4'-Chloro-2,2':6',2''-terpyridine, 97%
cas: 128143-89-5 — see every product listed under this CAS number, including other names
4'-Chloro-2,2':6',2''-terpyridine, 97% (CAS 128143-89-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A212007-250mg |
| cas | 128143-89-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 898.81 Pln | |
| Ambeed | 10g | 1705.38 Pln | |
| Ambeed | 25g | 3735.69 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 264.38 Pln | |
| BLDpharm | 5g | 964.13 Pln | |
| BLDpharm | 10g | 1830.49 Pln | |
| BLDpharm | 25g | 4024.16 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-chloro-2,6-dipyridin-2-ylpyridine (CAS 128143-89-5) is a chemical compound with the molecular formula C15H10ClN3 and a molecular weight of 267.71 g/mol. IUPAC name: 4-chloro-2,6-dipyridin-2-ylpyridine. InChIKey: AHEMFMCEBIJRMU-UHFFFAOYSA-N.
| Molecular formula | C15H10ClN3 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | 4-chloro-2,6-dipyridin-2-ylpyridine |
| InChIKey | AHEMFMCEBIJRMU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)Cl |
Computed by PubChem (NCBI)