cas: 1280786-72-2 — see every product listed under this CAS number, including other names
4'-Fluoro-3'-nitro-[1,1'-biphenyl]-3-carboxylic acid (CAS 1280786-72-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218726-1G |
| cas | 1280786-72-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1539.06 Pln |
| delivery time | 2-3 weeks |
|---|
3-(4-fluoro-3-nitrophenyl)benzoic acid (CAS 1280786-72-2) is a chemical compound with the molecular formula C13H8FNO4 and a molecular weight of 261.20 g/mol. IUPAC name: 3-(4-fluoro-3-nitrophenyl)benzoic acid. InChIKey: TXSMMXNGTYCZST-UHFFFAOYSA-N.
| Molecular formula | C13H8FNO4 |
|---|---|
| Molecular weight | 261.20 g/mol |
| IUPAC name | 3-(4-fluoro-3-nitrophenyl)benzoic acid |
| InChIKey | TXSMMXNGTYCZST-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC(=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)