CAS 1280786-72-2 appears in our catalog under these names: 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid, 96%, 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid, 4'-Fluoro-3'-nitro-[1,1'-biphenyl]-3-carboxylic acid. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 2,5g.
3-(4-fluoro-3-nitrophenyl)benzoic acid (CAS 1280786-72-2) is a chemical compound with the molecular formula C13H8FNO4 and a molecular weight of 261.20 g/mol. IUPAC name: 3-(4-fluoro-3-nitrophenyl)benzoic acid. InChIKey: TXSMMXNGTYCZST-UHFFFAOYSA-N.
| Molecular formula | C13H8FNO4 |
|---|---|
| Molecular weight | 261.20 g/mol |
| IUPAC name | 3-(4-fluoro-3-nitrophenyl)benzoic acid |
| InChIKey | TXSMMXNGTYCZST-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC(=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)