cas: 10540-45-1 — see every product listed under this CAS number, including other names
4'-Fluorobiphenyl-3-ylamine (CAS 10540-45-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014349-250MG |
| cas | 10540-45-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 482.14 Pln | |
| Fluorochem | 1g | 1299.56 Pln | |
| Fluorochem | 5g | 4131.90 Pln |
| delivery time | 3-4 weeks |
|---|
3-(4-fluorophenyl)aniline (CAS 10540-45-1) is a chemical compound with the molecular formula C12H10FN and a molecular weight of 187.21 g/mol. IUPAC name: 3-(4-fluorophenyl)aniline. InChIKey: ILWUJLSKEHCTSA-UHFFFAOYSA-N.
| Molecular formula | C12H10FN |
|---|---|
| Molecular weight | 187.21 g/mol |
| IUPAC name | 3-(4-fluorophenyl)aniline |
| InChIKey | ILWUJLSKEHCTSA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)