cas: 58743-77-4 — see every product listed under this CAS number, including other names
4'-Methoxy-[1,1'-biphenyl]-4-carbonitrile, 95%, 95% (CAS 58743-77-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EBT3-100mg |
| cas | 58743-77-4 |
| size | 100mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 386.00 Pln | |
| Chemat | 5g | 1115.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(4-methoxyphenyl)benzonitrile (CAS 58743-77-4) is a chemical compound with the molecular formula C14H11NO and a molecular weight of 209.24 g/mol. IUPAC name: 4-(4-methoxyphenyl)benzonitrile. InChIKey: RINYLKSNGRLNCU-UHFFFAOYSA-N.
| Molecular formula | C14H11NO |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)benzonitrile |
| InChIKey | RINYLKSNGRLNCU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)