cas: 59662-47-4 — see every product listed under this CAS number, including other names
4'-Pentyl-[1,1'-biphenyl]-4-carboxylic acid, 98%, 98% (CAS 59662-47-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E08I-100mg |
| cas | 59662-47-4 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 731.60 Pln | |
| Chemat | 5g | 2387.60 Pln | |
| Chemat | 10g | 4134.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4-pentylphenyl)benzoic acid (CAS 59662-47-4) is a chemical compound with the molecular formula C18H20O2 and a molecular weight of 268.3 g/mol. IUPAC name: 4-(4-pentylphenyl)benzoic acid. InChIKey: VRGQQLFRUKMDSW-UHFFFAOYSA-N.
| Molecular formula | C18H20O2 |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 4-(4-pentylphenyl)benzoic acid |
| InChIKey | VRGQQLFRUKMDSW-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)