cas: 7478-69-5 — see every product listed under this CAS number, including other names
4'-VINYLIDENEBIS(N,N-DIMETHYLANILINE), 98% (CAS 7478-69-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387005-1G |
| cas | 7478-69-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 409.25 Pln | |
| Fluorochem | 5g | 1455.76 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-[1-[4-(dimethylamino)phenyl]ethenyl]-N,N-dimethylaniline (CAS 7478-69-5) is a chemical compound with the molecular formula C18H22N2 and a molecular weight of 266.4 g/mol. IUPAC name: 4-[1-[4-(dimethylamino)phenyl]ethenyl]-N,N-dimethylaniline. InChIKey: HBWITNNIJDLPLS-UHFFFAOYSA-N.
| Molecular formula | C18H22N2 |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | 4-[1-[4-(dimethylamino)phenyl]ethenyl]-N,N-dimethylaniline |
| InChIKey | HBWITNNIJDLPLS-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=C)C2=CC=C(C=C2)N(C)C |
Computed by PubChem (NCBI)