CAS 7478-69-5 appears in our catalog under these names: 4,4'-Vinylidenebis(n,n-dimethylaniline), 95%, 4–Vinylidenebis(N,N–dimethylaniline), 4-Vinylidenebis(N,N-dimethylaniline) 97%, 4-Vinylidenebis(N,N-dimethylaniline), 98%, 98%, 4'-VINYLIDENEBIS(N,N-DIMETHYLANILINE), 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 25g, 1g, 5g, 100mg.
4-[1-[4-(dimethylamino)phenyl]ethenyl]-N,N-dimethylaniline (CAS 7478-69-5) is a chemical compound with the molecular formula C18H22N2 and a molecular weight of 266.4 g/mol. IUPAC name: 4-[1-[4-(dimethylamino)phenyl]ethenyl]-N,N-dimethylaniline. InChIKey: HBWITNNIJDLPLS-UHFFFAOYSA-N.
| Molecular formula | C18H22N2 |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | 4-[1-[4-(dimethylamino)phenyl]ethenyl]-N,N-dimethylaniline |
| InChIKey | HBWITNNIJDLPLS-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=C)C2=CC=C(C=C2)N(C)C |
Computed by PubChem (NCBI)