cas: 139092-78-7 — see every product listed under this CAS number, including other names
4,4',4''-Tri-9-carbazolyltriphenylamine (purified by sublimation), >99.0%(HPLC)(N) (CAS 139092-78-7) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T2274-200MG |
| cas | 139092-78-7 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 231.44 Pln | |
| TCI | 1g | 816.59 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >99.0%(HPLC)(N) |
4-carbazol-9-yl-N,N-bis(4-carbazol-9-ylphenyl)aniline (CAS 139092-78-7) is a chemical compound with the molecular formula C54H36N4 and a molecular weight of 740.9 g/mol. IUPAC name: 4-carbazol-9-yl-N,N-bis(4-carbazol-9-ylphenyl)aniline. InChIKey: AWXGSYPUMWKTBR-UHFFFAOYSA-N.
| Molecular formula | C54H36N4 |
|---|---|
| Molecular weight | 740.9 g/mol |
| IUPAC name | 4-carbazol-9-yl-N,N-bis(4-carbazol-9-ylphenyl)aniline |
| InChIKey | AWXGSYPUMWKTBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=C(C=C4)N(C5=CC=C(C=C5)N6C7=CC=CC=C7C8=CC=CC=C86)C9=CC=C(C=C9)N1C2=CC=CC=C2C2=CC=CC=C21 |
Computed by PubChem (NCBI)