cas: 139092-78-7 — see every product listed under this CAS number, including other names
Tris(4-(9H-carbazol-9-yl)phenyl)amine, 95% (CAS 139092-78-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F791109-250MG |
| cas | 139092-78-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 685.19 Pln | |
| Fluorochem | 25g | 2012.85 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-carbazol-9-yl-N,N-bis(4-carbazol-9-ylphenyl)aniline (CAS 139092-78-7) is a chemical compound with the molecular formula C54H36N4 and a molecular weight of 740.9 g/mol. IUPAC name: 4-carbazol-9-yl-N,N-bis(4-carbazol-9-ylphenyl)aniline. InChIKey: AWXGSYPUMWKTBR-UHFFFAOYSA-N.
| Molecular formula | C54H36N4 |
|---|---|
| Molecular weight | 740.9 g/mol |
| IUPAC name | 4-carbazol-9-yl-N,N-bis(4-carbazol-9-ylphenyl)aniline |
| InChIKey | AWXGSYPUMWKTBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=C(C=C4)N(C5=CC=C(C=C5)N6C7=CC=CC=C7C8=CC=CC=C86)C9=CC=C(C=C9)N1C2=CC=CC=C2C2=CC=CC=C21 |
Computed by PubChem (NCBI)