4,4'-((4-Aminophenyl)methylene)bis(N,N-dimethylaniline), 95%
cas: 633-02-3 — see every product listed under this CAS number, including other names
4,4'-((4-Aminophenyl)methylene)bis(N,N-dimethylaniline), 95% (CAS 633-02-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1809789-100mg |
| cas | 633-02-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 531.69 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 2183.75 Pln | |
| Ambeed | 5g | 6405.69 Pln | |
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 578.00 Pln | |
| Chemat | 1g | 1456.40 Pln | |
| Chemat | 5g | 4245.20 Pln | |
| BLDpharm | 100mg | 519.84 Pln | |
| BLDpharm | 250mg | 841.95 Pln | |
| BLDpharm | 1g | 2141.49 Pln | |
| BLDpharm | 5g | 6278.92 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-[bis[4-(dimethylamino)phenyl]methyl]aniline (CAS 633-02-3) is a chemical compound with the molecular formula C23H27N3 and a molecular weight of 345.5 g/mol. IUPAC name: 4-[bis[4-(dimethylamino)phenyl]methyl]aniline. InChIKey: TVAAWIWWRZDCBU-UHFFFAOYSA-N.
| Molecular formula | C23H27N3 |
|---|---|
| Molecular weight | 345.5 g/mol |
| IUPAC name | 4-[bis[4-(dimethylamino)phenyl]methyl]aniline |
| InChIKey | TVAAWIWWRZDCBU-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N(C)C |
Computed by PubChem (NCBI)
Synonyms:
4,4'-((4-aminophenyl)methylene)bis(N,N-dimethylaniline), 4-[bis[4-(dimethylamino)phenyl]methyl]aniline, Gentian Violet Impurity 2, 4-[bis(4-dimethylaminophenyl)methyl]aniline, 4,4''-((4-Aminophenyl)methylene)bis(N,N-dimethylaniline), Benzenamine, 4,4'-[(4-aminophenyl)methylene]bis[N,N-dimethyl-