CAS 633-02-3 appears in our catalog under these names: 4,4'-((4-Aminophenyl)methylene)bis(N,N-dimethylaniline), 95%, 95%, 4,4'-((4-Aminophenyl)methylene)bis(N,N-dimethylaniline), 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-[bis[4-(dimethylamino)phenyl]methyl]aniline (CAS 633-02-3) is a chemical compound with the molecular formula C23H27N3 and a molecular weight of 345.5 g/mol. IUPAC name: 4-[bis[4-(dimethylamino)phenyl]methyl]aniline. InChIKey: TVAAWIWWRZDCBU-UHFFFAOYSA-N.
| Molecular formula | C23H27N3 |
|---|---|
| Molecular weight | 345.5 g/mol |
| IUPAC name | 4-[bis[4-(dimethylamino)phenyl]methyl]aniline |
| InChIKey | TVAAWIWWRZDCBU-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N(C)C |
Computed by PubChem (NCBI)