cas: 104104-12-3 — see every product listed under this CAS number, including other names
4,4'-((Oxybis(ethane-2,1-diyl))bis(oxy))bis(methoxybenzene), 98%(GC-MS),RG, 98%(GC-MS),RG (CAS 104104-12-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ODB-100mg |
| cas | 104104-12-3 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 25g | 3683.60 Pln |
| purity | 98%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
1-methoxy-4-[2-[2-(4-methoxyphenoxy)ethoxy]ethoxy]benzene (CAS 104104-12-3) is a chemical compound with the molecular formula C18H22O5 and a molecular weight of 318.4 g/mol. IUPAC name: 1-methoxy-4-[2-[2-(4-methoxyphenoxy)ethoxy]ethoxy]benzene. InChIKey: AJXHXSKQHBJNPB-UHFFFAOYSA-N.
| Molecular formula | C18H22O5 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 1-methoxy-4-[2-[2-(4-methoxyphenoxy)ethoxy]ethoxy]benzene |
| InChIKey | AJXHXSKQHBJNPB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OCCOCCOC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)